| # | ICAO code
|
Name
|
# of related pictures |
IATA code
|
Country
|
Geolocation
|
Municipality
|
Type
|
Elevation (ft)
|
Longest runway length (m)
|
Passengers [in 2018]*
|
Info (external)
|
Website (external)
|
# of related air shows in DB |
# of related air museums in DB |
# of aeroclubs in DB |
# of related collections |
# of related user comments |
![[I]](pic/icon/magnifier.png){kind=icon}
![[A]](pic/icon/add.png){kind=icon}
|
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 1 | LOXZ | Zeltweg Air Base | 1 |
Austria |
![[I]](pic/icon/map.png){kind=icon} N471208 E0144432 |
Zeltweg | Airport | 2 238 | 2 750 | ![[I]](pic/icon/link.png){kind=icon} |
![[C]](pic/icon/comment.png){kind=icon}
![[P]](pic/icon/photo.png){kind=icon}
|
||||||||
| 2 | LOWZ | Zell am See Airport |
Austria |
N471729 E0124724 |
Zell Am See | Airport | 2 474 | 664 | |
|
|
||||||||
| 3 | LOKW | Wolfsberg Airport |
Austria |
N464904 E0144930 |
Wolfsberg | Airport | 1 463 | 747 | |
|
|||||||||
| 4 | LOXN | Wiener Neustadt West Airport |
Austria |
N475022 E0161318 |
Wiener Neustadt | Airport | 941 | 1 625 | |
|
|||||||||
| 5 | LOAN | Wiener Neustadt East Airport | 1 |
Austria |
N475036 E0161536 |
Wiener Neustadt | Airport | 896 | 1 067 | |
|
|
|||||||
| 6 | LOLW | Wels Airport | 1 |
Austria |
N481059 E0140224 |
Wels | Airport | 1 043 | 1 390 | |
|
|
|||||||
| 7 | LOGW | Weiz-Unterfladnitz Airport |
Austria |
N471012 E0153952 |
Weiz | Airport | 1 296 | 440 | |
|
|||||||||
| 8 | LOAD | Völtendorf Airport |
Austria |
N480937 E0153516 |
Voeltendorf | Airport | 1 062 | 582 | |
|
|||||||||
| 9 | LOWW | Vienna International Airport | 1 |
VIE |
Austria |
N480637 E0163411 |
Vienna | Large airport | 600 | 3 500 | 27 037 292 | |
|
1 |
|
||||
| 10 | LOAT | Trausdorf Airport |
Austria |
N474757 E0163328 |
Eisenstadt | Closed | 538 | 1 158 | |
|
|||||||||
| 11 | LOAU | Stockerau Airport |
Austria |
N482433 E0161128 |
Stockerau | Airport | 692 | 796 | |
|
|||||||||
| 12 | LOAS | Spitzerberg Airport |
Austria |
N480556 E0165600 |
Spitzerberg | Airport | 620 | 698 | |
|
|||||||||
| 13 | LOLT | Seitenstetten Airport |
Austria |
N480300 E0143945 |
Seitenstetten | Airport | 1 053 | 808 | |
|
|||||||||
| 14 | LOXS | Schwaz Heliport |
Austria |
N472006 E0114151 |
Salzburg | Heliport | 1 781 | |
|
||||||||||
| 15 | LOLC | Scharnstein Airport |
Austria |
N475352 E0135618 |
Scharnstein | Airport | 1 745 | 588 | |
|
|||||||||
| 16 | LOLS | Schärding-Suben Airport |
Austria |
N482410 E0132654 |
Schaerding / Suben | Airport | 1 072 | 802 | |
|
|||||||||
| 17 | LOIT | Sankt Johann in Tirol Heliport |
Austria |
N473115 E0122547 |
St Johann In Tirol | Heliport | 2 123 | |
|
||||||||||
| 18 | LOIJ | Sankt Johann Airport |
Austria |
N473113 E0122658 |
St. Johann In Tirol | Airport | 2 211 | 744 | |
|
|||||||||
| 19 | LOLG | Sankt Georgen Airport |
Austria |
N480611 E0145703 |
St. Georgen Am Ybbsfelde | Airport | 830 | 475 | |
|
|||||||||
| 20 | LOWS | Salzburg Airport | 1 |
SZG |
Austria |
N474740 E0130012 |
Salzburg | Airport | 1 411 | 2 750 | 1 890 164 | |
|
1 |
|
||||
| 21 | LOLK | Ried-Kirchheim Airport |
Austria |
N481244 E0132045 |
Ried | Airport | 1 384 | 744 | |
|
|||||||||
| 22 | LOIR | Reutte-Höfen Airport |
Austria |
N472816 E0104130 |
Reutte | Airport | 2 808 | 704 | |
|
|||||||||
| 23 | LOAR | Retzer Land Heliport |
Austria |
N484516 E0155744 |
Altlichtenwarth | Airport | 800 | |
|
||||||||||
| 24 | LOGG | Punitz-Güssing Airport |
Austria |
N470848 E0161901 |
Punitz | Airport | 951 | 817 | |
|
|||||||||
| 25 | LOGP | Pinkafeld Airport |
Austria |
N472312 E0160646 |
Pinkafeld | Airport | 1 341 | 616 | |
|
|||||||||
| 5 | 28 927 456 | 0 | 1 | 0 | 1 | 0 | |||||||||||||
| # | ICAO code
|
Name
|
# of related pictures |
IATA code
|
Country
|
Geolocation
|
Municipality
|
Type
|
Elevation (ft)
|
Longest runway length (m)
|
Passengers [in 2018]*
|
Info (external)
|
Website (external)
|
# of related air shows in DB |
# of related air museums in DB |
# of aeroclubs in DB |
# of related collections |
# of related user comments |
|